C31H36F2N4O3 — CID 18446870
N-[2-[1-[3-[[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]amino]propyl]piperidin-4-yl]-3-pyridinyl]-2-methylpropanamide (PubChem CID 18446870) has the molecular formula C31H36F2N4O3 and a molecular weight of 550.65 g/mol. Its IUPAC name is N-[2-[1-[3-[[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]amino]propyl]piperidin-4-yl]-3-pyridinyl]-2-methylpropanamide.
| Compound Name | N-[2-[1-[3-[[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]amino]propyl]piperidin-4-yl]-3-pyridinyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 18446870 |
| Molecular Formula | C31H36F2N4O3 |
| Molecular Weight | 550.65 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | N-[2-[1-[3-[[2,2-bis(4-fluorophenyl)-2-hydroxyacetyl]amino]propyl]piperidin-4-yl]-3-pyridinyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cccnc1C1CCN(CCCNC(=O)C(O)(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C31H36F2N4O3/c1-21(2)29(38)36-27-5-3-16-34-28(27)22-14-19-37(20-15-22)18-4-17-35-30(39)31(40,23-6-10-25(32)11-7-23)24-8-12-26(33)13-9-24/h3,5-13,16,21-22,40H,4,14-15,17-20H2,1-2H3,(H,35,39)(H,36,38) |
| InChIKey | SXGSPQXICQFKQT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|