1,2-dichloroethanesulfonyl chloride

C2H3Cl3O2S — CID 18446999

IUPAC1,2-dichloroethanesulfonyl chloride
SMILESO=S(=O)(Cl)C(Cl)CCl
InChIInChI=1S/C2H3Cl3O2S/c3-1-2(4)8(5,6)7/h2H,1H2
InChIKeyOHQUBRWYXSQPKU-UHFFFAOYSA-N
MW197.47 g/mol
LogP1.36
Rot. Bonds2

About 1,2-dichloroethanesulfonyl chloride

1,2-dichloroethanesulfonyl chloride (PubChem CID 18446999) has the molecular formula C2H3Cl3O2S and a molecular weight of 197.47 g/mol. Its IUPAC name is 1,2-dichloroethanesulfonyl chloride.

Molecular Properties

Compound Name1,2-dichloroethanesulfonyl chloride
PubChem CID18446999
Molecular FormulaC2H3Cl3O2S
Molecular Weight197.47 g/mol
Exact Mass195.89
IUPAC Name1,2-dichloroethanesulfonyl chloride
SMILESO=S(=O)(Cl)C(Cl)CCl
InChIInChI=1S/C2H3Cl3O2S/c3-1-2(4)8(5,6)7/h2H,1H2
InChIKeyOHQUBRWYXSQPKU-UHFFFAOYSA-N
XLogP1.36
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.47
LogP ≤ 51.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 1,2-dichloroethanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-dichloroethanesulfonyl chloride?
The IUPAC name of 1,2-dichloroethanesulfonyl chloride (CID 18446999) is 1,2-dichloroethanesulfonyl chloride.
What is the SMILES notation for 1,2-dichloroethanesulfonyl chloride?
The canonical SMILES for 1,2-dichloroethanesulfonyl chloride is O=S(=O)(Cl)C(Cl)CCl.
What is the InChIKey of 1,2-dichloroethanesulfonyl chloride?
The InChIKey is OHQUBRWYXSQPKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3Cl3O2S/c3-1-2(4)8(5,6)7/h2H,1H2.
What are the key properties of 1,2-dichloroethanesulfonyl chloride?
1,2-dichloroethanesulfonyl chloride has a molecular weight of 197.47 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloroethanesulfonyl chloride is sourced from PubChem (CID 18446999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).