About 2-(6,7-dimethyl-1H-indazol-5-yl)acetate
2-(6,7-dimethyl-1H-indazol-5-yl)acetate (PubChem CID 18447211) has the molecular formula C11H11N2O2-
and a molecular weight of 203.22 g/mol. Its IUPAC name is 2-(6,7-dimethyl-1H-indazol-5-yl)acetate.
Molecular Properties
| Compound Name | 2-(6,7-dimethyl-1H-indazol-5-yl)acetate |
| PubChem CID | 18447211 |
| Molecular Formula | C11H11N2O2- |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2-(6,7-dimethyl-1H-indazol-5-yl)acetate |
| SMILES | Cc1c(CC(=O)[O-])cc2cn[nH]c2c1C |
| InChI | InChI=1S/C11H12N2O2/c1-6-7(2)11-9(5-12-13-11)3-8(6)4-10(14)15/h3,5H,4H2,1-2H3,(H,12,13)(H,14,15)/p-1 |
| InChIKey | HMDVHIQNOCIQJJ-UHFFFAOYSA-M |
| XLogP | 0.47 |
| TPSA | 68.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6,7-dimethyl-1H-indazol-5-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,7-dimethyl-1H-indazol-5-yl)acetate?
The IUPAC name of 2-(6,7-dimethyl-1H-indazol-5-yl)acetate (CID 18447211) is 2-(6,7-dimethyl-1H-indazol-5-yl)acetate.
What is the SMILES notation for 2-(6,7-dimethyl-1H-indazol-5-yl)acetate?
The canonical SMILES for 2-(6,7-dimethyl-1H-indazol-5-yl)acetate is Cc1c(CC(=O)[O-])cc2cn[nH]c2c1C.
What is the InChIKey of 2-(6,7-dimethyl-1H-indazol-5-yl)acetate?
The InChIKey is HMDVHIQNOCIQJJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H12N2O2/c1-6-7(2)11-9(5-12-13-11)3-8(6)4-10(14)15/h3,5H,4H2,1-2H3,(H,12,13)(H,14,15)/p-1.
What are the key properties of 2-(6,7-dimethyl-1H-indazol-5-yl)acetate?
2-(6,7-dimethyl-1H-indazol-5-yl)acetate has a molecular weight of 203.22 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dimethyl-1H-indazol-5-yl)acetate is sourced from PubChem (CID 18447211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).