About (4-hydroxycyclohexyl) N-tert-butylcarbamate
(4-hydroxycyclohexyl) N-tert-butylcarbamate (PubChem CID 18447546) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is (4-hydroxycyclohexyl) N-tert-butylcarbamate.
Molecular Properties
| Compound Name | (4-hydroxycyclohexyl) N-tert-butylcarbamate |
| PubChem CID | 18447546 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (4-hydroxycyclohexyl) N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CCC(O)CC1 |
| InChI | InChI=1S/C11H21NO3/c1-11(2,3)12-10(14)15-9-6-4-8(13)5-7-9/h8-9,13H,4-7H2,1-3H3,(H,12,14) |
| InChIKey | GULDRNHZIHYVPA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-hydroxycyclohexyl) N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxycyclohexyl) N-tert-butylcarbamate?
The IUPAC name of (4-hydroxycyclohexyl) N-tert-butylcarbamate (CID 18447546) is (4-hydroxycyclohexyl) N-tert-butylcarbamate.
What is the SMILES notation for (4-hydroxycyclohexyl) N-tert-butylcarbamate?
The canonical SMILES for (4-hydroxycyclohexyl) N-tert-butylcarbamate is CC(C)(C)NC(=O)OC1CCC(O)CC1.
What is the InChIKey of (4-hydroxycyclohexyl) N-tert-butylcarbamate?
The InChIKey is GULDRNHZIHYVPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c1-11(2,3)12-10(14)15-9-6-4-8(13)5-7-9/h8-9,13H,4-7H2,1-3H3,(H,12,14).
What are the key properties of (4-hydroxycyclohexyl) N-tert-butylcarbamate?
(4-hydroxycyclohexyl) N-tert-butylcarbamate has a molecular weight of 215.29 g/mol, XLogP of 1.81, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxycyclohexyl) N-tert-butylcarbamate is sourced from PubChem (CID 18447546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).