C22H28N4O3 — CID 18447870
(7aS)-1,3-dioxo-2-[4-[1-(pyrrolidin-1-ylmethyl)cyclobutyl]phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide (PubChem CID 18447870) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is (7aS)-1,3-dioxo-2-[4-[1-(pyrrolidin-1-ylmethyl)cyclobutyl]phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide.
| Compound Name | (7aS)-1,3-dioxo-2-[4-[1-(pyrrolidin-1-ylmethyl)cyclobutyl]phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide |
|---|---|
| PubChem CID | 18447870 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (7aS)-1,3-dioxo-2-[4-[1-(pyrrolidin-1-ylmethyl)cyclobutyl]phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide |
| SMILES | NC(=O)[C@]12CCCN1C(=O)N(c1ccc(C3(CN4CCCC4)CCC3)cc1)C2=O |
| InChI | InChI=1S/C22H28N4O3/c23-18(27)22-11-4-14-25(22)20(29)26(19(22)28)17-7-5-16(6-8-17)21(9-3-10-21)15-24-12-1-2-13-24/h5-8H,1-4,9-15H2,(H2,23,27)/t22-/m0/s1 |
| InChIKey | PCVQNBRNHGCXJI-QFIPXVFZSA-N |
| XLogP | 1.99 |
| TPSA | 86.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|