C18H20N4O4 — CID 18447873
(7aS)-1,3-dioxo-2-[4-(2-oxopiperidin-1-yl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide (PubChem CID 18447873) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is (7aS)-1,3-dioxo-2-[4-(2-oxopiperidin-1-yl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide.
| Compound Name | (7aS)-1,3-dioxo-2-[4-(2-oxopiperidin-1-yl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide |
|---|---|
| PubChem CID | 18447873 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (7aS)-1,3-dioxo-2-[4-(2-oxopiperidin-1-yl)phenyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide |
| SMILES | NC(=O)[C@]12CCCN1C(=O)N(c1ccc(N3CCCCC3=O)cc1)C2=O |
| InChI | InChI=1S/C18H20N4O4/c19-15(24)18-9-3-11-21(18)17(26)22(16(18)25)13-7-5-12(6-8-13)20-10-2-1-4-14(20)23/h5-8H,1-4,9-11H2,(H2,19,24)/t18-/m0/s1 |
| InChIKey | JVGYSJHPTDKASF-SFHVURJKSA-N |
| XLogP | 0.99 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|