C22H28N4O4 — CID 18447897
(7aS)-2-[4-[1-(morpholin-4-ylmethyl)cyclobutyl]phenyl]-1,3-dioxo-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide (PubChem CID 18447897) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is (7aS)-2-[4-[1-(morpholin-4-ylmethyl)cyclobutyl]phenyl]-1,3-dioxo-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide.
| Compound Name | (7aS)-2-[4-[1-(morpholin-4-ylmethyl)cyclobutyl]phenyl]-1,3-dioxo-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide |
|---|---|
| PubChem CID | 18447897 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (7aS)-2-[4-[1-(morpholin-4-ylmethyl)cyclobutyl]phenyl]-1,3-dioxo-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-7a-carboxamide |
| SMILES | NC(=O)[C@]12CCCN1C(=O)N(c1ccc(C3(CN4CCOCC4)CCC3)cc1)C2=O |
| InChI | InChI=1S/C22H28N4O4/c23-18(27)22-9-2-10-25(22)20(29)26(19(22)28)17-5-3-16(4-6-17)21(7-1-8-21)15-24-11-13-30-14-12-24/h3-6H,1-2,7-15H2,(H2,23,27)/t22-/m0/s1 |
| InChIKey | XYLJHFZOTLYCAK-QFIPXVFZSA-N |
| XLogP | 1.23 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|