C17H23N5O2 — CID 18447922
(8aR)-2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-3-oxo-5,6,7,8-tetrahydro-1H-imidazo[1,5-a]pyridine-8a-carboxamide (PubChem CID 18447922) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is (8aR)-2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-3-oxo-5,6,7,8-tetrahydro-1H-imidazo[1,5-a]pyridine-8a-carboxamide.
| Compound Name | (8aR)-2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-3-oxo-5,6,7,8-tetrahydro-1H-imidazo[1,5-a]pyridine-8a-carboxamide |
|---|---|
| PubChem CID | 18447922 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | (8aR)-2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-3-oxo-5,6,7,8-tetrahydro-1H-imidazo[1,5-a]pyridine-8a-carboxamide |
| SMILES | [H]/N=C(/c1ccc(N2C[C@@]3(C(N)=O)CCCCN3C2=O)cc1)N(C)C |
| InChI | InChI=1S/C17H23N5O2/c1-20(2)14(18)12-5-7-13(8-6-12)21-11-17(15(19)23)9-3-4-10-22(17)16(21)24/h5-8,18H,3-4,9-11H2,1-2H3,(H2,19,23)/b18-14-/t17-/m1/s1 |
| InChIKey | MIYQOXOZGXNAQC-OLCHLOJWSA-N |
| XLogP | 1.22 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|