C17H21N5O3 — CID 18447946
(8aS)-2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-1,3-dioxo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-8a-carboxamide (PubChem CID 18447946) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is (8aS)-2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-1,3-dioxo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-8a-carboxamide.
| Compound Name | (8aS)-2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-1,3-dioxo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-8a-carboxamide |
|---|---|
| PubChem CID | 18447946 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | (8aS)-2-[4-(N,N-dimethylcarbamimidoyl)phenyl]-1,3-dioxo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-8a-carboxamide |
| SMILES | [H]/N=C(/c1ccc(N2C(=O)N3CCCC[C@]3(C(N)=O)C2=O)cc1)N(C)C |
| InChI | InChI=1S/C17H21N5O3/c1-20(2)13(18)11-5-7-12(8-6-11)22-15(24)17(14(19)23)9-3-4-10-21(17)16(22)25/h5-8,18H,3-4,9-10H2,1-2H3,(H2,19,23)/b18-13-/t17-/m0/s1 |
| InChIKey | RAAVETWIFRGZIZ-XIDKLXSXSA-N |
| XLogP | 0.75 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|