About 5-(2,4-dimethoxyphenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine
5-(2,4-dimethoxyphenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine (PubChem CID 18449319) has the molecular formula C21H31N3O2
and a molecular weight of 357.50 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine.
Molecular Properties
| Compound Name | 5-(2,4-dimethoxyphenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine |
| PubChem CID | 18449319 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine |
| SMILES | CCc1nc(-c2ccc(OC)cc2OC)c(CC)nc1NC(CC)CC |
| InChI | InChI=1S/C21H31N3O2/c1-7-14(8-2)22-21-18(10-4)23-20(17(9-3)24-21)16-12-11-15(25-5)13-19(16)26-6/h11-14H,7-10H2,1-6H3,(H,22,24) |
| InChIKey | XLUVAJCDSFXIDU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2,4-dimethoxyphenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dimethoxyphenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine?
The IUPAC name of 5-(2,4-dimethoxyphenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine (CID 18449319) is 5-(2,4-dimethoxyphenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine.
What is the SMILES notation for 5-(2,4-dimethoxyphenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine?
The canonical SMILES for 5-(2,4-dimethoxyphenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine is CCc1nc(-c2ccc(OC)cc2OC)c(CC)nc1NC(CC)CC.
What is the InChIKey of 5-(2,4-dimethoxyphenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine?
The InChIKey is XLUVAJCDSFXIDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31N3O2/c1-7-14(8-2)22-21-18(10-4)23-20(17(9-3)24-21)16-12-11-15(25-5)13-19(16)26-6/h11-14H,7-10H2,1-6H3,(H,22,24).
What are the key properties of 5-(2,4-dimethoxyphenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine?
5-(2,4-dimethoxyphenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine has a molecular weight of 357.50 g/mol, XLogP of 4.89, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dimethoxyphenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine is sourced from PubChem (CID 18449319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).