C12H12ClN3O2 — CID 18449392
5-amino-4-chloro-1'-methylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione (PubChem CID 18449392) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is 5-amino-4-chloro-1'-methylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione.
| Compound Name | 5-amino-4-chloro-1'-methylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 18449392 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 5-amino-4-chloro-1'-methylspiro[1,3-dihydroindene-2,5'-imidazolidine]-2',4'-dione |
| SMILES | CN1C(=O)NC(=O)C12Cc1ccc(N)c(Cl)c1C2 |
| InChI | InChI=1S/C12H12ClN3O2/c1-16-11(18)15-10(17)12(16)4-6-2-3-8(14)9(13)7(6)5-12/h2-3H,4-5,14H2,1H3,(H,15,17,18) |
| InChIKey | FWKHALUTMUOVMT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|