About 3-[2-(2-aminophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)-7H-purine-2,6-dione
3-[2-(2-aminophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)-7H-purine-2,6-dione (PubChem CID 18449430) has the molecular formula C18H21N9O2
and a molecular weight of 395.43 g/mol. Its IUPAC name is 3-[2-(2-aminophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)-7H-purine-2,6-dione.
Molecular Properties
| Compound Name | 3-[2-(2-aminophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)-7H-purine-2,6-dione |
| PubChem CID | 18449430 |
| Molecular Formula | C18H21N9O2 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 3-[2-(2-aminophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(Cc3nn[nH]n3)nc2n(CCc2ccccc2N)c1=O |
| InChI | InChI=1S/C18H21N9O2/c1-2-8-27-17(28)15-16(21-13(20-15)10-14-22-24-25-23-14)26(18(27)29)9-7-11-5-3-4-6-12(11)19/h3-6H,2,7-10,19H2,1H3,(H,20,21)(H,22,23,24,25) |
| InChIKey | HUOFOWGAKVAKDL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 153.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2-aminophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)-7H-purine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-aminophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)-7H-purine-2,6-dione?
The IUPAC name of 3-[2-(2-aminophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)-7H-purine-2,6-dione (CID 18449430) is 3-[2-(2-aminophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)-7H-purine-2,6-dione.
What is the SMILES notation for 3-[2-(2-aminophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)-7H-purine-2,6-dione?
The canonical SMILES for 3-[2-(2-aminophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)-7H-purine-2,6-dione is CCCn1c(=O)c2[nH]c(Cc3nn[nH]n3)nc2n(CCc2ccccc2N)c1=O.
What is the InChIKey of 3-[2-(2-aminophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)-7H-purine-2,6-dione?
The InChIKey is HUOFOWGAKVAKDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N9O2/c1-2-8-27-17(28)15-16(21-13(20-15)10-14-22-24-25-23-14)26(18(27)29)9-7-11-5-3-4-6-12(11)19/h3-6H,2,7-10,19H2,1H3,(H,20,21)(H,22,23,24,25).
What are the key properties of 3-[2-(2-aminophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)-7H-purine-2,6-dione?
3-[2-(2-aminophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)-7H-purine-2,6-dione has a molecular weight of 395.43 g/mol, XLogP of 0.23, 7 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-aminophenyl)ethyl]-1-propyl-8-(2H-tetrazol-5-ylmethyl)-7H-purine-2,6-dione is sourced from PubChem (CID 18449430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).