C20H21FN6O3 — CID 18449484
3-[2-(4-aminophenyl)ethyl]-8-[(5-fluoro-1,3-oxazol-2-yl)methyl]-1-propyl-7H-purine-2,6-dione (PubChem CID 18449484) has the molecular formula C20H21FN6O3 and a molecular weight of 412.43 g/mol. Its IUPAC name is 3-[2-(4-aminophenyl)ethyl]-8-[(5-fluoro-1,3-oxazol-2-yl)methyl]-1-propyl-7H-purine-2,6-dione.
| Compound Name | 3-[2-(4-aminophenyl)ethyl]-8-[(5-fluoro-1,3-oxazol-2-yl)methyl]-1-propyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 18449484 |
| Molecular Formula | C20H21FN6O3 |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 3-[2-(4-aminophenyl)ethyl]-8-[(5-fluoro-1,3-oxazol-2-yl)methyl]-1-propyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(Cc3ncc(F)o3)nc2n(CCc2ccc(N)cc2)c1=O |
| InChI | InChI=1S/C20H21FN6O3/c1-2-8-27-19(28)17-18(25-15(24-17)10-16-23-11-14(21)30-16)26(20(27)29)9-7-12-3-5-13(22)6-4-12/h3-6,11H,2,7-10,22H2,1H3,(H,24,25) |
| InChIKey | QXPFQMPIGYXGTJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 124.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|