C24H12N2O4 — CID 18449797
17,28-dioxa-3,13-diazaheptacyclo[14.12.0.02,10.04,9.011,15.018,27.020,25]octacosa-1,4,6,8,10,15,18,20,22,24,26-undecaene-12,14-dione (PubChem CID 18449797) has the molecular formula C24H12N2O4 and a molecular weight of 392.37 g/mol. Its IUPAC name is 17,28-dioxa-3,13-diazaheptacyclo[14.12.0.02,10.04,9.011,15.018,27.020,25]octacosa-1,4,6,8,10,15,18,20,22,24,26-undecaene-12,14-dione.
| Compound Name | 17,28-dioxa-3,13-diazaheptacyclo[14.12.0.02,10.04,9.011,15.018,27.020,25]octacosa-1,4,6,8,10,15,18,20,22,24,26-undecaene-12,14-dione |
|---|---|
| PubChem CID | 18449797 |
| Molecular Formula | C24H12N2O4 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 17,28-dioxa-3,13-diazaheptacyclo[14.12.0.02,10.04,9.011,15.018,27.020,25]octacosa-1,4,6,8,10,15,18,20,22,24,26-undecaene-12,14-dione |
| SMILES | O=c1[nH]c(=O)c2c1c1oc3cc4ccccc4cc3oc1c1[nH]c3ccccc3c12 |
| InChI | InChI=1S/C24H12N2O4/c27-23-18-17-13-7-3-4-8-14(13)25-20(17)22-21(19(18)24(28)26-23)29-15-9-11-5-1-2-6-12(11)10-16(15)30-22/h1-10,25H,(H,26,27,28) |
| InChIKey | PHIMDBIDFOKQJY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|