C8H4Cl2N2O2 — CID 1845
6,7-dichloro-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 1845) has the molecular formula C8H4Cl2N2O2 and a molecular weight of 231.04 g/mol. Its IUPAC name is 6,7-dichloro-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6,7-dichloro-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 1845 |
| Molecular Formula | C8H4Cl2N2O2 |
| Molecular Weight | 231.04 g/mol |
| Exact Mass | 229.96 |
| IUPAC Name | 6,7-dichloro-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc(Cl)c(Cl)cc2[nH]c1=O |
| InChI | InChI=1S/C8H4Cl2N2O2/c9-3-1-5-6(2-4(3)10)12-8(14)7(13)11-5/h1-2H,(H,11,13)(H,12,14) |
| InChIKey | AVBSIKMUAFYZAV-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.04 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|