About N,N-dimethylcyclopenta-1,3-dien-1-amine;titanium(2+);dichloride
N,N-dimethylcyclopenta-1,3-dien-1-amine;titanium(2+);dichloride (PubChem CID 18450420) has the molecular formula C7H11Cl2NTi
and a molecular weight of 227.94 g/mol. Its IUPAC name is N,N-dimethylcyclopenta-1,3-dien-1-amine;titanium(2+);dichloride.
Molecular Properties
| Compound Name | N,N-dimethylcyclopenta-1,3-dien-1-amine;titanium(2+);dichloride |
| PubChem CID | 18450420 |
| Molecular Formula | C7H11Cl2NTi |
| Molecular Weight | 227.94 g/mol |
| Exact Mass | 226.97 |
| IUPAC Name | N,N-dimethylcyclopenta-1,3-dien-1-amine;titanium(2+);dichloride |
| SMILES | CN(C)C1=CC=CC1.[Cl-].[Cl-].[Ti+2] |
| InChI | InChI=1S/C7H11N.2ClH.Ti/c1-8(2)7-5-3-4-6-7;;;/h3-5H,6H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | CPYYTLLGNPSOPC-UHFFFAOYSA-L |
| XLogP | -4.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.94 |
| LogP ≤ 5 | -4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylcyclopenta-1,3-dien-1-amine;titanium(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylcyclopenta-1,3-dien-1-amine;titanium(2+);dichloride?
The IUPAC name of N,N-dimethylcyclopenta-1,3-dien-1-amine;titanium(2+);dichloride (CID 18450420) is N,N-dimethylcyclopenta-1,3-dien-1-amine;titanium(2+);dichloride.
What is the SMILES notation for N,N-dimethylcyclopenta-1,3-dien-1-amine;titanium(2+);dichloride?
The canonical SMILES for N,N-dimethylcyclopenta-1,3-dien-1-amine;titanium(2+);dichloride is CN(C)C1=CC=CC1.[Cl-].[Cl-].[Ti+2].
What is the InChIKey of N,N-dimethylcyclopenta-1,3-dien-1-amine;titanium(2+);dichloride?
The InChIKey is CPYYTLLGNPSOPC-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H11N.2ClH.Ti/c1-8(2)7-5-3-4-6-7;;;/h3-5H,6H2,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of N,N-dimethylcyclopenta-1,3-dien-1-amine;titanium(2+);dichloride?
N,N-dimethylcyclopenta-1,3-dien-1-amine;titanium(2+);dichloride has a molecular weight of 227.94 g/mol, XLogP of -4.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylcyclopenta-1,3-dien-1-amine;titanium(2+);dichloride is sourced from PubChem (CID 18450420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).