About 2-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-N-(3-methylphenyl)acetamide
2-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-N-(3-methylphenyl)acetamide (PubChem CID 18450549) has the molecular formula C22H19N3OS
and a molecular weight of 373.48 g/mol. Its IUPAC name is 2-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-N-(3-methylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-N-(3-methylphenyl)acetamide |
| PubChem CID | 18450549 |
| Molecular Formula | C22H19N3OS |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cc2ccc(-c3csc4ccnc(N)c34)cc2)c1 |
| InChI | InChI=1S/C22H19N3OS/c1-14-3-2-4-17(11-14)25-20(26)12-15-5-7-16(8-6-15)18-13-27-19-9-10-24-22(23)21(18)19/h2-11,13H,12H2,1H3,(H2,23,24)(H,25,26) |
| InChIKey | GVEFXOFPHJTMJZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-N-(3-methylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-N-(3-methylphenyl)acetamide?
The IUPAC name of 2-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-N-(3-methylphenyl)acetamide (CID 18450549) is 2-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-N-(3-methylphenyl)acetamide.
What is the SMILES notation for 2-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-N-(3-methylphenyl)acetamide?
The canonical SMILES for 2-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-N-(3-methylphenyl)acetamide is Cc1cccc(NC(=O)Cc2ccc(-c3csc4ccnc(N)c34)cc2)c1.
What is the InChIKey of 2-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-N-(3-methylphenyl)acetamide?
The InChIKey is GVEFXOFPHJTMJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3OS/c1-14-3-2-4-17(11-14)25-20(26)12-15-5-7-16(8-6-15)18-13-27-19-9-10-24-22(23)21(18)19/h2-11,13H,12H2,1H3,(H2,23,24)(H,25,26).
What are the key properties of 2-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-N-(3-methylphenyl)acetamide?
2-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-N-(3-methylphenyl)acetamide has a molecular weight of 373.48 g/mol, XLogP of 5.04, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-N-(3-methylphenyl)acetamide is sourced from PubChem (CID 18450549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).