About 3-bromothieno[3,2-c]pyridin-4-amine
3-bromothieno[3,2-c]pyridin-4-amine (PubChem CID 18450797) has the molecular formula C7H5BrN2S
and a molecular weight of 229.10 g/mol. Its IUPAC name is 3-bromothieno[3,2-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 3-bromothieno[3,2-c]pyridin-4-amine |
| PubChem CID | 18450797 |
| Molecular Formula | C7H5BrN2S |
| Molecular Weight | 229.10 g/mol |
| Exact Mass | 227.94 |
| IUPAC Name | 3-bromothieno[3,2-c]pyridin-4-amine |
| SMILES | Nc1nccc2scc(Br)c12 |
| InChI | InChI=1S/C7H5BrN2S/c8-4-3-11-5-1-2-10-7(9)6(4)5/h1-3H,(H2,9,10) |
| InChIKey | NRVPVUKWJYSNTO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.10 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromothieno[3,2-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromothieno[3,2-c]pyridin-4-amine?
The IUPAC name of 3-bromothieno[3,2-c]pyridin-4-amine (CID 18450797) is 3-bromothieno[3,2-c]pyridin-4-amine.
What is the SMILES notation for 3-bromothieno[3,2-c]pyridin-4-amine?
The canonical SMILES for 3-bromothieno[3,2-c]pyridin-4-amine is Nc1nccc2scc(Br)c12.
What is the InChIKey of 3-bromothieno[3,2-c]pyridin-4-amine?
The InChIKey is NRVPVUKWJYSNTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrN2S/c8-4-3-11-5-1-2-10-7(9)6(4)5/h1-3H,(H2,9,10).
What are the key properties of 3-bromothieno[3,2-c]pyridin-4-amine?
3-bromothieno[3,2-c]pyridin-4-amine has a molecular weight of 229.10 g/mol, XLogP of 2.64, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromothieno[3,2-c]pyridin-4-amine is sourced from PubChem (CID 18450797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).