C22H21N5O3S — CID 18451053
N-[4-[4-amino-7-[(E)-3-oxo-3-(3-oxopiperazin-1-yl)prop-1-enyl]thieno[3,2-c]pyridin-3-yl]phenyl]acetamide (PubChem CID 18451053) has the molecular formula C22H21N5O3S and a molecular weight of 435.51 g/mol. Its IUPAC name is N-[4-[4-amino-7-[(E)-3-oxo-3-(3-oxopiperazin-1-yl)prop-1-enyl]thieno[3,2-c]pyridin-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-amino-7-[(E)-3-oxo-3-(3-oxopiperazin-1-yl)prop-1-enyl]thieno[3,2-c]pyridin-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 18451053 |
| Molecular Formula | C22H21N5O3S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-[4-[4-amino-7-[(E)-3-oxo-3-(3-oxopiperazin-1-yl)prop-1-enyl]thieno[3,2-c]pyridin-3-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2csc3c(/C=C/C(=O)N4CCNC(=O)C4)cnc(N)c23)cc1 |
| InChI | InChI=1S/C22H21N5O3S/c1-13(28)26-16-5-2-14(3-6-16)17-12-31-21-15(10-25-22(23)20(17)21)4-7-19(30)27-9-8-24-18(29)11-27/h2-7,10,12H,8-9,11H2,1H3,(H2,23,25)(H,24,29)(H,26,28)/b7-4+ |
| InChIKey | ZKBZXELVVDZXGQ-QPJJXVBHSA-N |
| XLogP | 2.48 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|