About 1-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-3-(3,4-dimethylphenyl)urea
1-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-3-(3,4-dimethylphenyl)urea (PubChem CID 18451364) has the molecular formula C22H20N4OS
and a molecular weight of 388.50 g/mol. Its IUPAC name is 1-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-3-(3,4-dimethylphenyl)urea.
Molecular Properties
| Compound Name | 1-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-3-(3,4-dimethylphenyl)urea |
| PubChem CID | 18451364 |
| Molecular Formula | C22H20N4OS |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-3-(3,4-dimethylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc(-c3csc4ccnc(N)c34)cc2)cc1C |
| InChI | InChI=1S/C22H20N4OS/c1-13-3-6-17(11-14(13)2)26-22(27)25-16-7-4-15(5-8-16)18-12-28-19-9-10-24-21(23)20(18)19/h3-12H,1-2H3,(H2,23,24)(H2,25,26,27) |
| InChIKey | QDQMPEDWNLGXSA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-3-(3,4-dimethylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-3-(3,4-dimethylphenyl)urea?
The IUPAC name of 1-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-3-(3,4-dimethylphenyl)urea (CID 18451364) is 1-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-3-(3,4-dimethylphenyl)urea.
What is the SMILES notation for 1-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-3-(3,4-dimethylphenyl)urea?
The canonical SMILES for 1-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-3-(3,4-dimethylphenyl)urea is Cc1ccc(NC(=O)Nc2ccc(-c3csc4ccnc(N)c34)cc2)cc1C.
What is the InChIKey of 1-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-3-(3,4-dimethylphenyl)urea?
The InChIKey is QDQMPEDWNLGXSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4OS/c1-13-3-6-17(11-14(13)2)26-22(27)25-16-7-4-15(5-8-16)18-12-28-19-9-10-24-21(23)20(18)19/h3-12H,1-2H3,(H2,23,24)(H2,25,26,27).
What are the key properties of 1-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-3-(3,4-dimethylphenyl)urea?
1-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-3-(3,4-dimethylphenyl)urea has a molecular weight of 388.50 g/mol, XLogP of 5.81, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-aminothieno[3,2-c]pyridin-3-yl)phenyl]-3-(3,4-dimethylphenyl)urea is sourced from PubChem (CID 18451364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).