About 5-aminopiperidin-2-one
5-aminopiperidin-2-one (PubChem CID 18451415) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is 5-aminopiperidin-2-one.
Molecular Properties
| Compound Name | 5-aminopiperidin-2-one |
| PubChem CID | 18451415 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 5-aminopiperidin-2-one |
| SMILES | NC1CCC(=O)NC1 |
| InChI | InChI=1S/C5H10N2O/c6-4-1-2-5(8)7-3-4/h4H,1-3,6H2,(H,7,8) |
| InChIKey | APDCFRUAEFSNPV-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-aminopiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminopiperidin-2-one?
The IUPAC name of 5-aminopiperidin-2-one (CID 18451415) is 5-aminopiperidin-2-one.
What is the SMILES notation for 5-aminopiperidin-2-one?
The canonical SMILES for 5-aminopiperidin-2-one is NC1CCC(=O)NC1.
What is the InChIKey of 5-aminopiperidin-2-one?
The InChIKey is APDCFRUAEFSNPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O/c6-4-1-2-5(8)7-3-4/h4H,1-3,6H2,(H,7,8).
What are the key properties of 5-aminopiperidin-2-one?
5-aminopiperidin-2-one has a molecular weight of 114.15 g/mol, XLogP of -0.78, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminopiperidin-2-one is sourced from PubChem (CID 18451415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).