About 2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)acetyl chloride
2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)acetyl chloride (PubChem CID 18451570) has the molecular formula C8H7ClOS
and a molecular weight of 186.66 g/mol. Its IUPAC name is 2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)acetyl chloride.
Molecular Properties
| Compound Name | 2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)acetyl chloride |
| PubChem CID | 18451570 |
| Molecular Formula | C8H7ClOS |
| Molecular Weight | 186.66 g/mol |
| Exact Mass | 185.99 |
| IUPAC Name | 2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)acetyl chloride |
| SMILES | O=C(Cl)CC1=CC=CCC1=S |
| InChI | InChI=1S/C8H7ClOS/c9-8(10)5-6-3-1-2-4-7(6)11/h1-3H,4-5H2 |
| InChIKey | YVQRNQHTZXEMAS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.66 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)acetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)acetyl chloride?
The IUPAC name of 2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)acetyl chloride (CID 18451570) is 2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)acetyl chloride.
What is the SMILES notation for 2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)acetyl chloride?
The canonical SMILES for 2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)acetyl chloride is O=C(Cl)CC1=CC=CCC1=S.
What is the InChIKey of 2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)acetyl chloride?
The InChIKey is YVQRNQHTZXEMAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClOS/c9-8(10)5-6-3-1-2-4-7(6)11/h1-3H,4-5H2.
What are the key properties of 2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)acetyl chloride?
2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)acetyl chloride has a molecular weight of 186.66 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)acetyl chloride is sourced from PubChem (CID 18451570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).