C7H14O6 — CID 18451710
(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-4-methylhexanal (PubChem CID 18451710) has the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-4-methylhexanal.
| Compound Name | (2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-4-methylhexanal |
|---|---|
| PubChem CID | 18451710 |
| Molecular Formula | C7H14O6 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | (2S,3R,4R,5R)-2,3,4,5,6-pentahydroxy-4-methylhexanal |
| SMILES | C[C@@](O)([C@H](O)CO)[C@H](O)[C@H](O)C=O |
| InChI | InChI=1S/C7H14O6/c1-7(13,5(11)3-9)6(12)4(10)2-8/h2,4-6,9-13H,3H2,1H3/t4-,5-,6-,7-/m1/s1 |
| InChIKey | XYQNWDJVZFWMKQ-DBRKOABJSA-N |
| XLogP | -2.99 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|