About 4-(6,7-difluoro-4-oxo-2H-1,3-benzoxazin-3-yl)benzoate
4-(6,7-difluoro-4-oxo-2H-1,3-benzoxazin-3-yl)benzoate (PubChem CID 18452498) has the molecular formula C15H8F2NO4-
and a molecular weight of 304.23 g/mol. Its IUPAC name is 4-(6,7-difluoro-4-oxo-2H-1,3-benzoxazin-3-yl)benzoate.
Molecular Properties
| Compound Name | 4-(6,7-difluoro-4-oxo-2H-1,3-benzoxazin-3-yl)benzoate |
| PubChem CID | 18452498 |
| Molecular Formula | C15H8F2NO4- |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 4-(6,7-difluoro-4-oxo-2H-1,3-benzoxazin-3-yl)benzoate |
| SMILES | O=C([O-])c1ccc(N2COc3cc(F)c(F)cc3C2=O)cc1 |
| InChI | InChI=1S/C15H9F2NO4/c16-11-5-10-13(6-12(11)17)22-7-18(14(10)19)9-3-1-8(2-4-9)15(20)21/h1-6H,7H2,(H,20,21)/p-1 |
| InChIKey | LUCYUTGKIPHICG-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(6,7-difluoro-4-oxo-2H-1,3-benzoxazin-3-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6,7-difluoro-4-oxo-2H-1,3-benzoxazin-3-yl)benzoate?
The IUPAC name of 4-(6,7-difluoro-4-oxo-2H-1,3-benzoxazin-3-yl)benzoate (CID 18452498) is 4-(6,7-difluoro-4-oxo-2H-1,3-benzoxazin-3-yl)benzoate.
What is the SMILES notation for 4-(6,7-difluoro-4-oxo-2H-1,3-benzoxazin-3-yl)benzoate?
The canonical SMILES for 4-(6,7-difluoro-4-oxo-2H-1,3-benzoxazin-3-yl)benzoate is O=C([O-])c1ccc(N2COc3cc(F)c(F)cc3C2=O)cc1.
What is the InChIKey of 4-(6,7-difluoro-4-oxo-2H-1,3-benzoxazin-3-yl)benzoate?
The InChIKey is LUCYUTGKIPHICG-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H9F2NO4/c16-11-5-10-13(6-12(11)17)22-7-18(14(10)19)9-3-1-8(2-4-9)15(20)21/h1-6H,7H2,(H,20,21)/p-1.
What are the key properties of 4-(6,7-difluoro-4-oxo-2H-1,3-benzoxazin-3-yl)benzoate?
4-(6,7-difluoro-4-oxo-2H-1,3-benzoxazin-3-yl)benzoate has a molecular weight of 304.23 g/mol, XLogP of 1.33, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6,7-difluoro-4-oxo-2H-1,3-benzoxazin-3-yl)benzoate is sourced from PubChem (CID 18452498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).