About 2-[4-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]butylsulfinyl]acetic acid
2-[4-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]butylsulfinyl]acetic acid (PubChem CID 18452617) has the molecular formula C25H29N3O3S
and a molecular weight of 451.59 g/mol. Its IUPAC name is 2-[4-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]butylsulfinyl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]butylsulfinyl]acetic acid |
| PubChem CID | 18452617 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 2-[4-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]butylsulfinyl]acetic acid |
| SMILES | CC(C)N(CCCCS(=O)CC(=O)O)c1cnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H29N3O3S/c1-19(2)28(15-9-10-16-32(31)18-23(29)30)22-17-26-24(20-11-5-3-6-12-20)25(27-22)21-13-7-4-8-14-21/h3-8,11-14,17,19H,9-10,15-16,18H2,1-2H3,(H,29,30) |
| InChIKey | LYTWBSZEUQJOJC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]butylsulfinyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]butylsulfinyl]acetic acid?
The IUPAC name of 2-[4-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]butylsulfinyl]acetic acid (CID 18452617) is 2-[4-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]butylsulfinyl]acetic acid.
What is the SMILES notation for 2-[4-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]butylsulfinyl]acetic acid?
The canonical SMILES for 2-[4-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]butylsulfinyl]acetic acid is CC(C)N(CCCCS(=O)CC(=O)O)c1cnc(-c2ccccc2)c(-c2ccccc2)n1.
What is the InChIKey of 2-[4-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]butylsulfinyl]acetic acid?
The InChIKey is LYTWBSZEUQJOJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N3O3S/c1-19(2)28(15-9-10-16-32(31)18-23(29)30)22-17-26-24(20-11-5-3-6-12-20)25(27-22)21-13-7-4-8-14-21/h3-8,11-14,17,19H,9-10,15-16,18H2,1-2H3,(H,29,30).
What are the key properties of 2-[4-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]butylsulfinyl]acetic acid?
2-[4-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]butylsulfinyl]acetic acid has a molecular weight of 451.59 g/mol, XLogP of 4.64, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(5,6-diphenylpyrazin-2-yl)-propan-2-ylamino]butylsulfinyl]acetic acid is sourced from PubChem (CID 18452617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).