About 2-[3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]ethyl]phenoxy]acetic acid
2-[3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]ethyl]phenoxy]acetic acid (PubChem CID 18452637) has the molecular formula C27H25N3O3
and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-[3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]ethyl]phenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]ethyl]phenoxy]acetic acid |
| PubChem CID | 18452637 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 2-[3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]ethyl]phenoxy]acetic acid |
| SMILES | CN(CCc1cccc(OCC(=O)O)c1)c1cnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C27H25N3O3/c1-30(16-15-20-9-8-14-23(17-20)33-19-25(31)32)24-18-28-26(21-10-4-2-5-11-21)27(29-24)22-12-6-3-7-13-22/h2-14,17-18H,15-16,19H2,1H3,(H,31,32) |
| InChIKey | IIZNVFDSFGYRQE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]ethyl]phenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]ethyl]phenoxy]acetic acid?
The IUPAC name of 2-[3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]ethyl]phenoxy]acetic acid (CID 18452637) is 2-[3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]ethyl]phenoxy]acetic acid.
What is the SMILES notation for 2-[3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]ethyl]phenoxy]acetic acid?
The canonical SMILES for 2-[3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]ethyl]phenoxy]acetic acid is CN(CCc1cccc(OCC(=O)O)c1)c1cnc(-c2ccccc2)c(-c2ccccc2)n1.
What is the InChIKey of 2-[3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]ethyl]phenoxy]acetic acid?
The InChIKey is IIZNVFDSFGYRQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25N3O3/c1-30(16-15-20-9-8-14-23(17-20)33-19-25(31)32)24-18-28-26(21-10-4-2-5-11-21)27(29-24)22-12-6-3-7-13-22/h2-14,17-18H,15-16,19H2,1H3,(H,31,32).
What are the key properties of 2-[3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]ethyl]phenoxy]acetic acid?
2-[3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]ethyl]phenoxy]acetic acid has a molecular weight of 439.52 g/mol, XLogP of 4.95, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]ethyl]phenoxy]acetic acid is sourced from PubChem (CID 18452637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).