About 3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]-1-hydroxyethyl]phenol
3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]-1-hydroxyethyl]phenol (PubChem CID 18452669) has the molecular formula C25H23N3O2
and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]-1-hydroxyethyl]phenol.
Molecular Properties
| Compound Name | 3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]-1-hydroxyethyl]phenol |
| PubChem CID | 18452669 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]-1-hydroxyethyl]phenol |
| SMILES | CN(CC(O)c1cccc(O)c1)c1cnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H23N3O2/c1-28(17-22(30)20-13-8-14-21(29)15-20)23-16-26-24(18-9-4-2-5-10-18)25(27-23)19-11-6-3-7-12-19/h2-16,22,29-30H,17H2,1H3 |
| InChIKey | UNGGTDDGVGIMEX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]-1-hydroxyethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]-1-hydroxyethyl]phenol?
The IUPAC name of 3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]-1-hydroxyethyl]phenol (CID 18452669) is 3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]-1-hydroxyethyl]phenol.
What is the SMILES notation for 3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]-1-hydroxyethyl]phenol?
The canonical SMILES for 3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]-1-hydroxyethyl]phenol is CN(CC(O)c1cccc(O)c1)c1cnc(-c2ccccc2)c(-c2ccccc2)n1.
What is the InChIKey of 3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]-1-hydroxyethyl]phenol?
The InChIKey is UNGGTDDGVGIMEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N3O2/c1-28(17-22(30)20-13-8-14-21(29)15-20)23-16-26-24(18-9-4-2-5-10-18)25(27-23)19-11-6-3-7-12-19/h2-16,22,29-30H,17H2,1H3.
What are the key properties of 3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]-1-hydroxyethyl]phenol?
3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]-1-hydroxyethyl]phenol has a molecular weight of 397.48 g/mol, XLogP of 4.69, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(5,6-diphenylpyrazin-2-yl)-methylamino]-1-hydroxyethyl]phenol is sourced from PubChem (CID 18452669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).