C20H26ClIN4O2 — CID 18452773
6-(7-chloro-5-methoxy-2,3-dihydroindol-1-yl)-5-iodo-2-methyl-N-(1-propoxypropyl)pyrimidin-4-amine (PubChem CID 18452773) has the molecular formula C20H26ClIN4O2 and a molecular weight of 516.81 g/mol. Its IUPAC name is 6-(7-chloro-5-methoxy-2,3-dihydroindol-1-yl)-5-iodo-2-methyl-N-(1-propoxypropyl)pyrimidin-4-amine.
| Compound Name | 6-(7-chloro-5-methoxy-2,3-dihydroindol-1-yl)-5-iodo-2-methyl-N-(1-propoxypropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 18452773 |
| Molecular Formula | C20H26ClIN4O2 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 6-(7-chloro-5-methoxy-2,3-dihydroindol-1-yl)-5-iodo-2-methyl-N-(1-propoxypropyl)pyrimidin-4-amine |
| SMILES | CCCOC(CC)Nc1nc(C)nc(N2CCc3cc(OC)cc(Cl)c32)c1I |
| InChI | InChI=1S/C20H26ClIN4O2/c1-5-9-28-16(6-2)25-19-17(22)20(24-12(3)23-19)26-8-7-13-10-14(27-4)11-15(21)18(13)26/h10-11,16H,5-9H2,1-4H3,(H,23,24,25) |
| InChIKey | YZVWOTPIDINXHT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|