About 2-methyl-2,3-dihydroimidazo[1,2-a]pyridine
2-methyl-2,3-dihydroimidazo[1,2-a]pyridine (PubChem CID 18452952) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2-methyl-2,3-dihydroimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2-methyl-2,3-dihydroimidazo[1,2-a]pyridine |
| PubChem CID | 18452952 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 2-methyl-2,3-dihydroimidazo[1,2-a]pyridine |
| SMILES | CC1CN2C=CC=CC2=N1 |
| InChI | InChI=1S/C8H10N2/c1-7-6-10-5-3-2-4-8(10)9-7/h2-5,7H,6H2,1H3 |
| InChIKey | CKZOFUOMDQBHEV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2,3-dihydroimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,3-dihydroimidazo[1,2-a]pyridine?
The IUPAC name of 2-methyl-2,3-dihydroimidazo[1,2-a]pyridine (CID 18452952) is 2-methyl-2,3-dihydroimidazo[1,2-a]pyridine.
What is the SMILES notation for 2-methyl-2,3-dihydroimidazo[1,2-a]pyridine?
The canonical SMILES for 2-methyl-2,3-dihydroimidazo[1,2-a]pyridine is CC1CN2C=CC=CC2=N1.
What is the InChIKey of 2-methyl-2,3-dihydroimidazo[1,2-a]pyridine?
The InChIKey is CKZOFUOMDQBHEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-7-6-10-5-3-2-4-8(10)9-7/h2-5,7H,6H2,1H3.
What are the key properties of 2-methyl-2,3-dihydroimidazo[1,2-a]pyridine?
2-methyl-2,3-dihydroimidazo[1,2-a]pyridine has a molecular weight of 134.18 g/mol, XLogP of 1.17, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,3-dihydroimidazo[1,2-a]pyridine is sourced from PubChem (CID 18452952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).