C18H12ClF4NO5S — CID 18453768
2-[6-chloro-5-hydroxy-2-methyl-1-[5-(1,1,2,2-tetrafluoroethoxy)thiophene-3-carbonyl]indol-3-yl]acetic acid (PubChem CID 18453768) has the molecular formula C18H12ClF4NO5S and a molecular weight of 465.81 g/mol. Its IUPAC name is 2-[6-chloro-5-hydroxy-2-methyl-1-[5-(1,1,2,2-tetrafluoroethoxy)thiophene-3-carbonyl]indol-3-yl]acetic acid.
| Compound Name | 2-[6-chloro-5-hydroxy-2-methyl-1-[5-(1,1,2,2-tetrafluoroethoxy)thiophene-3-carbonyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 18453768 |
| Molecular Formula | C18H12ClF4NO5S |
| Molecular Weight | 465.81 g/mol |
| Exact Mass | 465.01 |
| IUPAC Name | 2-[6-chloro-5-hydroxy-2-methyl-1-[5-(1,1,2,2-tetrafluoroethoxy)thiophene-3-carbonyl]indol-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2cc(O)c(Cl)cc2n1C(=O)c1csc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C18H12ClF4NO5S/c1-7-9(4-14(26)27)10-3-13(25)11(19)5-12(10)24(7)16(28)8-2-15(30-6-8)29-18(22,23)17(20)21/h2-3,5-6,17,25H,4H2,1H3,(H,26,27) |
| InChIKey | BFEDUAZRPHHTGX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.81 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|