C18H13ClF5NO3S2 — CID 18453787
2-[6-chloro-5-hydroxy-2-methyl-1-[[5-(1,1,2,2,2-pentafluoroethylsulfanyl)thiophen-2-yl]methyl]indol-3-yl]acetic acid (PubChem CID 18453787) has the molecular formula C18H13ClF5NO3S2 and a molecular weight of 485.88 g/mol. Its IUPAC name is 2-[6-chloro-5-hydroxy-2-methyl-1-[[5-(1,1,2,2,2-pentafluoroethylsulfanyl)thiophen-2-yl]methyl]indol-3-yl]acetic acid.
| Compound Name | 2-[6-chloro-5-hydroxy-2-methyl-1-[[5-(1,1,2,2,2-pentafluoroethylsulfanyl)thiophen-2-yl]methyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 18453787 |
| Molecular Formula | C18H13ClF5NO3S2 |
| Molecular Weight | 485.88 g/mol |
| Exact Mass | 484.99 |
| IUPAC Name | 2-[6-chloro-5-hydroxy-2-methyl-1-[[5-(1,1,2,2,2-pentafluoroethylsulfanyl)thiophen-2-yl]methyl]indol-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2cc(O)c(Cl)cc2n1Cc1ccc(SC(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C18H13ClF5NO3S2/c1-8-10(5-15(27)28)11-4-14(26)12(19)6-13(11)25(8)7-9-2-3-16(29-9)30-18(23,24)17(20,21)22/h2-4,6,26H,5,7H2,1H3,(H,27,28) |
| InChIKey | JYUPMSFKMHVFDK-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.88 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|