C21H16ClF4NO5 — CID 18453815
2-[6-chloro-5-methoxy-2-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)benzoyl]indol-3-yl]acetic acid (PubChem CID 18453815) has the molecular formula C21H16ClF4NO5 and a molecular weight of 473.81 g/mol. Its IUPAC name is 2-[6-chloro-5-methoxy-2-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)benzoyl]indol-3-yl]acetic acid.
| Compound Name | 2-[6-chloro-5-methoxy-2-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)benzoyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 18453815 |
| Molecular Formula | C21H16ClF4NO5 |
| Molecular Weight | 473.81 g/mol |
| Exact Mass | 473.07 |
| IUPAC Name | 2-[6-chloro-5-methoxy-2-methyl-1-[4-(1,1,2,2-tetrafluoroethoxy)benzoyl]indol-3-yl]acetic acid |
| SMILES | COc1cc2c(CC(=O)O)c(C)n(C(=O)c3ccc(OC(F)(F)C(F)F)cc3)c2cc1Cl |
| InChI | InChI=1S/C21H16ClF4NO5/c1-10-13(8-18(28)29)14-7-17(31-2)15(22)9-16(14)27(10)19(30)11-3-5-12(6-4-11)32-21(25,26)20(23)24/h3-7,9,20H,8H2,1-2H3,(H,28,29) |
| InChIKey | LJSVAILPFISWSN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.81 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|