C21H15ClF5NO5 — CID 18453821
2-[6-chloro-5-methoxy-2-methyl-1-[4-(1,1,2,2,2-pentafluoroethoxy)benzoyl]indol-3-yl]acetic acid (PubChem CID 18453821) has the molecular formula C21H15ClF5NO5 and a molecular weight of 491.80 g/mol. Its IUPAC name is 2-[6-chloro-5-methoxy-2-methyl-1-[4-(1,1,2,2,2-pentafluoroethoxy)benzoyl]indol-3-yl]acetic acid.
| Compound Name | 2-[6-chloro-5-methoxy-2-methyl-1-[4-(1,1,2,2,2-pentafluoroethoxy)benzoyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 18453821 |
| Molecular Formula | C21H15ClF5NO5 |
| Molecular Weight | 491.80 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 2-[6-chloro-5-methoxy-2-methyl-1-[4-(1,1,2,2,2-pentafluoroethoxy)benzoyl]indol-3-yl]acetic acid |
| SMILES | COc1cc2c(CC(=O)O)c(C)n(C(=O)c3ccc(OC(F)(F)C(F)(F)F)cc3)c2cc1Cl |
| InChI | InChI=1S/C21H15ClF5NO5/c1-10-13(8-18(29)30)14-7-17(32-2)15(22)9-16(14)28(10)19(31)11-3-5-12(6-4-11)33-21(26,27)20(23,24)25/h3-7,9H,8H2,1-2H3,(H,29,30) |
| InChIKey | TYNGVNRILIKFRX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.80 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|