C19H16F5NO4S — CID 18453965
2-[6-fluoro-5-methoxy-2-methyl-1-[[5-(1,1,2,2-tetrafluoroethoxy)thiophen-2-yl]methyl]indol-3-yl]acetic acid (PubChem CID 18453965) has the molecular formula C19H16F5NO4S and a molecular weight of 449.40 g/mol. Its IUPAC name is 2-[6-fluoro-5-methoxy-2-methyl-1-[[5-(1,1,2,2-tetrafluoroethoxy)thiophen-2-yl]methyl]indol-3-yl]acetic acid.
| Compound Name | 2-[6-fluoro-5-methoxy-2-methyl-1-[[5-(1,1,2,2-tetrafluoroethoxy)thiophen-2-yl]methyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 18453965 |
| Molecular Formula | C19H16F5NO4S |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 2-[6-fluoro-5-methoxy-2-methyl-1-[[5-(1,1,2,2-tetrafluoroethoxy)thiophen-2-yl]methyl]indol-3-yl]acetic acid |
| SMILES | COc1cc2c(CC(=O)O)c(C)n(Cc3ccc(OC(F)(F)C(F)F)s3)c2cc1F |
| InChI | InChI=1S/C19H16F5NO4S/c1-9-11(6-16(26)27)12-5-15(28-2)13(20)7-14(12)25(9)8-10-3-4-17(30-10)29-19(23,24)18(21)22/h3-5,7,18H,6,8H2,1-2H3,(H,26,27) |
| InChIKey | AICIZUNVCMBWKY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|