About CID 18454036
CID 18454036 (PubChem CID 18454036) has the molecular formula C26H54O6Si3
and a molecular weight of 546.97 g/mol.
Molecular Properties
| Compound Name | CID 18454036 |
| PubChem CID | 18454036 |
| Molecular Formula | C26H54O6Si3 |
| Molecular Weight | 546.97 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | — |
| SMILES | COC(OC)[Si]CCCCCC(C)(CCCCC[Si]C(OC)OC)CCCCC[Si]C(OC)OC |
| InChI | InChI=1S/C26H54O6Si3/c1-26(17-11-8-14-20-33-23(27-2)28-3,18-12-9-15-21-34-24(29-4)30-5)19-13-10-16-22-35-25(31-6)32-7/h23-25H,8-22H2,1-7H3 |
| InChIKey | SPWMCWQUAMSBMJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.97 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 18454036 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18454036?
The IUPAC name of CID 18454036 (CID 18454036) is not available.
What is the SMILES notation for CID 18454036?
The canonical SMILES for CID 18454036 is COC(OC)[Si]CCCCCC(C)(CCCCC[Si]C(OC)OC)CCCCC[Si]C(OC)OC.
What is the InChIKey of CID 18454036?
The InChIKey is SPWMCWQUAMSBMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H54O6Si3/c1-26(17-11-8-14-20-33-23(27-2)28-3,18-12-9-15-21-34-24(29-4)30-5)19-13-10-16-22-35-25(31-6)32-7/h23-25H,8-22H2,1-7H3.
What are the key properties of CID 18454036?
CID 18454036 has a molecular weight of 546.97 g/mol, XLogP of 5.77, 27 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18454036 is sourced from PubChem (CID 18454036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).