About hexan-1-ol;1-methyl-4-prop-1-en-2-ylcyclohexene
hexan-1-ol;1-methyl-4-prop-1-en-2-ylcyclohexene (PubChem CID 18454862) has the molecular formula C16H30O
and a molecular weight of 238.41 g/mol. Its IUPAC name is hexan-1-ol;1-methyl-4-prop-1-en-2-ylcyclohexene.
Molecular Properties
| Compound Name | hexan-1-ol;1-methyl-4-prop-1-en-2-ylcyclohexene |
| PubChem CID | 18454862 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | hexan-1-ol;1-methyl-4-prop-1-en-2-ylcyclohexene |
| SMILES | C=C(C)C1CC=C(C)CC1.CCCCCCO |
| InChI | InChI=1S/C10H16.C6H14O/c1-8(2)10-6-4-9(3)5-7-10;1-2-3-4-5-6-7/h4,10H,1,5-7H2,2-3H3;7H,2-6H2,1H3 |
| InChIKey | UDMVTTHGICAPKH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hexan-1-ol;1-methyl-4-prop-1-en-2-ylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-1-ol;1-methyl-4-prop-1-en-2-ylcyclohexene?
The IUPAC name of hexan-1-ol;1-methyl-4-prop-1-en-2-ylcyclohexene (CID 18454862) is hexan-1-ol;1-methyl-4-prop-1-en-2-ylcyclohexene.
What is the SMILES notation for hexan-1-ol;1-methyl-4-prop-1-en-2-ylcyclohexene?
The canonical SMILES for hexan-1-ol;1-methyl-4-prop-1-en-2-ylcyclohexene is C=C(C)C1CC=C(C)CC1.CCCCCCO.
What is the InChIKey of hexan-1-ol;1-methyl-4-prop-1-en-2-ylcyclohexene?
The InChIKey is UDMVTTHGICAPKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C6H14O/c1-8(2)10-6-4-9(3)5-7-10;1-2-3-4-5-6-7/h4,10H,1,5-7H2,2-3H3;7H,2-6H2,1H3.
What are the key properties of hexan-1-ol;1-methyl-4-prop-1-en-2-ylcyclohexene?
hexan-1-ol;1-methyl-4-prop-1-en-2-ylcyclohexene has a molecular weight of 238.41 g/mol, XLogP of 4.87, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-1-ol;1-methyl-4-prop-1-en-2-ylcyclohexene is sourced from PubChem (CID 18454862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).