About 2H-pyrimidine-1,2,4-triamine
2H-pyrimidine-1,2,4-triamine (PubChem CID 18455683) has the molecular formula C4H9N5
and a molecular weight of 127.15 g/mol. Its IUPAC name is 2H-pyrimidine-1,2,4-triamine.
Molecular Properties
| Compound Name | 2H-pyrimidine-1,2,4-triamine |
| PubChem CID | 18455683 |
| Molecular Formula | C4H9N5 |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.09 |
| IUPAC Name | 2H-pyrimidine-1,2,4-triamine |
| SMILES | NC1=NC(N)N(N)C=C1 |
| InChI | InChI=1S/C4H9N5/c5-3-1-2-9(7)4(6)8-3/h1-2,4H,6-7H2,(H2,5,8) |
| InChIKey | CLQJQZUNNQYPOW-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 93.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2H-pyrimidine-1,2,4-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrimidine-1,2,4-triamine?
The IUPAC name of 2H-pyrimidine-1,2,4-triamine (CID 18455683) is 2H-pyrimidine-1,2,4-triamine.
What is the SMILES notation for 2H-pyrimidine-1,2,4-triamine?
The canonical SMILES for 2H-pyrimidine-1,2,4-triamine is NC1=NC(N)N(N)C=C1.
What is the InChIKey of 2H-pyrimidine-1,2,4-triamine?
The InChIKey is CLQJQZUNNQYPOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N5/c5-3-1-2-9(7)4(6)8-3/h1-2,4H,6-7H2,(H2,5,8).
What are the key properties of 2H-pyrimidine-1,2,4-triamine?
2H-pyrimidine-1,2,4-triamine has a molecular weight of 127.15 g/mol, XLogP of -1.71, 0 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrimidine-1,2,4-triamine is sourced from PubChem (CID 18455683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).