C15H22FN3O — CID 18455851
(9R,13R)-5-(ethoxymethyl)-4-(fluoromethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene (PubChem CID 18455851) has the molecular formula C15H22FN3O and a molecular weight of 279.36 g/mol. Its IUPAC name is (9R,13R)-5-(ethoxymethyl)-4-(fluoromethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene.
| Compound Name | (9R,13R)-5-(ethoxymethyl)-4-(fluoromethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 18455851 |
| Molecular Formula | C15H22FN3O |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (9R,13R)-5-(ethoxymethyl)-4-(fluoromethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene |
| SMILES | CCOCc1cc2c(nc1CF)N1[C@@H](CNC[C@H]1C)C2 |
| InChI | InChI=1S/C15H22FN3O/c1-3-20-9-12-4-11-5-13-8-17-7-10(2)19(13)15(11)18-14(12)6-16/h4,10,13,17H,3,5-9H2,1-2H3/t10-,13-/m1/s1 |
| InChIKey | ZYMCQBCIQTZWPD-ZWNOBZJWSA-N |
| XLogP | 1.81 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |