C23H25F6N3O5 — CID 18455861
(9R,13R)-13-methyl-5-(phenylmethoxymethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid) (PubChem CID 18455861) has the molecular formula C23H25F6N3O5 and a molecular weight of 537.46 g/mol. Its IUPAC name is (9R,13R)-13-methyl-5-(phenylmethoxymethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (9R,13R)-13-methyl-5-(phenylmethoxymethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 18455861 |
| Molecular Formula | C23H25F6N3O5 |
| Molecular Weight | 537.46 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | (9R,13R)-13-methyl-5-(phenylmethoxymethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C[C@@H]1CNC[C@H]2Cc3cc(COCc4ccccc4)cnc3N21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H23N3O.2C2HF3O2/c1-14-9-20-11-18-8-17-7-16(10-21-19(17)22(14)18)13-23-12-15-5-3-2-4-6-15;2*3-2(4,5)1(6)7/h2-7,10,14,18,20H,8-9,11-13H2,1H3;2*(H,6,7)/t14-,18-;;/m1../s1 |
| InChIKey | QVTRHNAAVLBWOX-ROIBWGDASA-N |
| XLogP | 3.79 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |