C12H15BrFN3 — CID 18455886
(9R,13R)-5-bromo-4-(fluoromethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene (PubChem CID 18455886) has the molecular formula C12H15BrFN3 and a molecular weight of 300.18 g/mol. Its IUPAC name is (9R,13R)-5-bromo-4-(fluoromethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene.
| Compound Name | (9R,13R)-5-bromo-4-(fluoromethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 18455886 |
| Molecular Formula | C12H15BrFN3 |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | (9R,13R)-5-bromo-4-(fluoromethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2,4,6-triene |
| SMILES | C[C@@H]1CNC[C@H]2Cc3cc(Br)c(CF)nc3N21 |
| InChI | InChI=1S/C12H15BrFN3/c1-7-5-15-6-9-2-8-3-10(13)11(4-14)16-12(8)17(7)9/h3,7,9,15H,2,4-6H2,1H3/t7-,9-/m1/s1 |
| InChIKey | MFPGYTQNQKUDKZ-VXNVDRBHSA-N |
| XLogP | 2.04 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |