C18H23F6N3O5 — CID 18455924
(9R,13R)-5-(ethoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid) (PubChem CID 18455924) has the molecular formula C18H23F6N3O5 and a molecular weight of 475.39 g/mol. Its IUPAC name is (9R,13R)-5-(ethoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (9R,13R)-5-(ethoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 18455924 |
| Molecular Formula | C18H23F6N3O5 |
| Molecular Weight | 475.39 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (9R,13R)-5-(ethoxymethyl)-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCOCc1cnc2c(c1)C[C@@H]1CNC[C@@H](C)N21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21N3O.2C2HF3O2/c1-3-18-9-11-4-12-5-13-8-15-6-10(2)17(13)14(12)16-7-11;2*3-2(4,5)1(6)7/h4,7,10,13,15H,3,5-6,8-9H2,1-2H3;2*(H,6,7)/t10-,13-;;/m1../s1 |
| InChIKey | RVTBEXZGKMPGAG-OWVUFADGSA-N |
| XLogP | 2.61 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |