C17H21F6N3O4 — CID 18455930
(9R,13R)-5-ethyl-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid) (PubChem CID 18455930) has the molecular formula C17H21F6N3O4 and a molecular weight of 445.36 g/mol. Its IUPAC name is (9R,13R)-5-ethyl-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (9R,13R)-5-ethyl-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 18455930 |
| Molecular Formula | C17H21F6N3O4 |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (9R,13R)-5-ethyl-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCc1cnc2c(c1)C[C@@H]1CNC[C@@H](C)N21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H19N3.2C2HF3O2/c1-3-10-4-11-5-12-8-14-6-9(2)16(12)13(11)15-7-10;2*3-2(4,5)1(6)7/h4,7,9,12,14H,3,5-6,8H2,1-2H3;2*(H,6,7)/t9-,12-;;/m1../s1 |
| InChIKey | PUCQMKGFDMQOOY-SLNAEPSVSA-N |
| XLogP | 2.63 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |