About 5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid
5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid (PubChem CID 18455978) has the molecular formula C10H8N2O4
and a molecular weight of 220.18 g/mol. Its IUPAC name is 5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | 5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid |
| PubChem CID | 18455978 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid |
| SMILES | Cc1cnc2c(c1)cc(C(=O)O)n2C(=O)O |
| InChI | InChI=1S/C10H8N2O4/c1-5-2-6-3-7(9(13)14)12(10(15)16)8(6)11-4-5/h2-4H,1H3,(H,13,14)(H,15,16) |
| InChIKey | KTFXWQOHSYWONI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid?
The IUPAC name of 5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid (CID 18455978) is 5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid.
What is the SMILES notation for 5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid?
The canonical SMILES for 5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid is Cc1cnc2c(c1)cc(C(=O)O)n2C(=O)O.
What is the InChIKey of 5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid?
The InChIKey is KTFXWQOHSYWONI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O4/c1-5-2-6-3-7(9(13)14)12(10(15)16)8(6)11-4-5/h2-4H,1H3,(H,13,14)(H,15,16).
What are the key properties of 5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid?
5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid has a molecular weight of 220.18 g/mol, XLogP of 1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylpyrrolo[2,3-b]pyridine-1,2-dicarboxylic acid is sourced from PubChem (CID 18455978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).