C18H26ClF3N2O — CID 18456182
1-(4-pentan-3-ylpiperazin-1-yl)-2-[4-(trifluoromethyl)phenyl]ethanone;hydrochloride (PubChem CID 18456182) has the molecular formula C18H26ClF3N2O and a molecular weight of 378.87 g/mol. Its IUPAC name is 1-(4-pentan-3-ylpiperazin-1-yl)-2-[4-(trifluoromethyl)phenyl]ethanone;hydrochloride.
| Compound Name | 1-(4-pentan-3-ylpiperazin-1-yl)-2-[4-(trifluoromethyl)phenyl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 18456182 |
| Molecular Formula | C18H26ClF3N2O |
| Molecular Weight | 378.87 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-(4-pentan-3-ylpiperazin-1-yl)-2-[4-(trifluoromethyl)phenyl]ethanone;hydrochloride |
| SMILES | CCC(CC)N1CCN(C(=O)Cc2ccc(C(F)(F)F)cc2)CC1.Cl |
| InChI | InChI=1S/C18H25F3N2O.ClH/c1-3-16(4-2)22-9-11-23(12-10-22)17(24)13-14-5-7-15(8-6-14)18(19,20)21;/h5-8,16H,3-4,9-13H2,1-2H3;1H |
| InChIKey | KKURRDQGHKHWTE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.87 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |