About 1-(4-fluorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)butane-1,4-dione;hydrochloride
1-(4-fluorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)butane-1,4-dione;hydrochloride (PubChem CID 18456190) has the molecular formula C19H28ClFN2O2
and a molecular weight of 370.90 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)butane-1,4-dione;hydrochloride.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)butane-1,4-dione;hydrochloride |
| PubChem CID | 18456190 |
| Molecular Formula | C19H28ClFN2O2 |
| Molecular Weight | 370.90 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)butane-1,4-dione;hydrochloride |
| SMILES | CCC(CC)N1CCN(C(=O)CCC(=O)c2ccc(F)cc2)CC1.Cl |
| InChI | InChI=1S/C19H27FN2O2.ClH/c1-3-17(4-2)21-11-13-22(14-12-21)19(24)10-9-18(23)15-5-7-16(20)8-6-15;/h5-8,17H,3-4,9-14H2,1-2H3;1H |
| InChIKey | ISNGAARJZNDTFU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.90 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-fluorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)butane-1,4-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)butane-1,4-dione;hydrochloride?
The IUPAC name of 1-(4-fluorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)butane-1,4-dione;hydrochloride (CID 18456190) is 1-(4-fluorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)butane-1,4-dione;hydrochloride.
What is the SMILES notation for 1-(4-fluorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)butane-1,4-dione;hydrochloride?
The canonical SMILES for 1-(4-fluorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)butane-1,4-dione;hydrochloride is CCC(CC)N1CCN(C(=O)CCC(=O)c2ccc(F)cc2)CC1.Cl.
What is the InChIKey of 1-(4-fluorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)butane-1,4-dione;hydrochloride?
The InChIKey is ISNGAARJZNDTFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27FN2O2.ClH/c1-3-17(4-2)21-11-13-22(14-12-21)19(24)10-9-18(23)15-5-7-16(20)8-6-15;/h5-8,17H,3-4,9-14H2,1-2H3;1H.
What are the key properties of 1-(4-fluorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)butane-1,4-dione;hydrochloride?
1-(4-fluorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)butane-1,4-dione;hydrochloride has a molecular weight of 370.90 g/mol, XLogP of 3.54, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)butane-1,4-dione;hydrochloride is sourced from PubChem (CID 18456190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).