C16H19F3N2O2 — CID 18456203
1-(4-prop-2-enylpiperazin-1-yl)-2-[3-(trifluoromethoxy)phenyl]ethanone (PubChem CID 18456203) has the molecular formula C16H19F3N2O2 and a molecular weight of 328.33 g/mol. Its IUPAC name is 1-(4-prop-2-enylpiperazin-1-yl)-2-[3-(trifluoromethoxy)phenyl]ethanone.
| Compound Name | 1-(4-prop-2-enylpiperazin-1-yl)-2-[3-(trifluoromethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 18456203 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-(4-prop-2-enylpiperazin-1-yl)-2-[3-(trifluoromethoxy)phenyl]ethanone |
| SMILES | C=CCN1CCN(C(=O)Cc2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C16H19F3N2O2/c1-2-6-20-7-9-21(10-8-20)15(22)12-13-4-3-5-14(11-13)23-16(17,18)19/h2-5,11H,1,6-10,12H2 |
| InChIKey | YPGUYEMIFJYBQG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|