About 1-(4-chlorophenyl)-4-[4-(2-methylbutan-2-yl)piperazin-1-yl]butane-1,4-dione;hydrochloride
1-(4-chlorophenyl)-4-[4-(2-methylbutan-2-yl)piperazin-1-yl]butane-1,4-dione;hydrochloride (PubChem CID 18456227) has the molecular formula C19H28Cl2N2O2
and a molecular weight of 387.35 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[4-(2-methylbutan-2-yl)piperazin-1-yl]butane-1,4-dione;hydrochloride.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-4-[4-(2-methylbutan-2-yl)piperazin-1-yl]butane-1,4-dione;hydrochloride |
| PubChem CID | 18456227 |
| Molecular Formula | C19H28Cl2N2O2 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[4-(2-methylbutan-2-yl)piperazin-1-yl]butane-1,4-dione;hydrochloride |
| SMILES | CCC(C)(C)N1CCN(C(=O)CCC(=O)c2ccc(Cl)cc2)CC1.Cl |
| InChI | InChI=1S/C19H27ClN2O2.ClH/c1-4-19(2,3)22-13-11-21(12-14-22)18(24)10-9-17(23)15-5-7-16(20)8-6-15;/h5-8H,4,9-14H2,1-3H3;1H |
| InChIKey | DMKSAHFLJOVCKH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chlorophenyl)-4-[4-(2-methylbutan-2-yl)piperazin-1-yl]butane-1,4-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-4-[4-(2-methylbutan-2-yl)piperazin-1-yl]butane-1,4-dione;hydrochloride?
The IUPAC name of 1-(4-chlorophenyl)-4-[4-(2-methylbutan-2-yl)piperazin-1-yl]butane-1,4-dione;hydrochloride (CID 18456227) is 1-(4-chlorophenyl)-4-[4-(2-methylbutan-2-yl)piperazin-1-yl]butane-1,4-dione;hydrochloride.
What is the SMILES notation for 1-(4-chlorophenyl)-4-[4-(2-methylbutan-2-yl)piperazin-1-yl]butane-1,4-dione;hydrochloride?
The canonical SMILES for 1-(4-chlorophenyl)-4-[4-(2-methylbutan-2-yl)piperazin-1-yl]butane-1,4-dione;hydrochloride is CCC(C)(C)N1CCN(C(=O)CCC(=O)c2ccc(Cl)cc2)CC1.Cl.
What is the InChIKey of 1-(4-chlorophenyl)-4-[4-(2-methylbutan-2-yl)piperazin-1-yl]butane-1,4-dione;hydrochloride?
The InChIKey is DMKSAHFLJOVCKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27ClN2O2.ClH/c1-4-19(2,3)22-13-11-21(12-14-22)18(24)10-9-17(23)15-5-7-16(20)8-6-15;/h5-8H,4,9-14H2,1-3H3;1H.
What are the key properties of 1-(4-chlorophenyl)-4-[4-(2-methylbutan-2-yl)piperazin-1-yl]butane-1,4-dione;hydrochloride?
1-(4-chlorophenyl)-4-[4-(2-methylbutan-2-yl)piperazin-1-yl]butane-1,4-dione;hydrochloride has a molecular weight of 387.35 g/mol, XLogP of 4.06, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-4-[4-(2-methylbutan-2-yl)piperazin-1-yl]butane-1,4-dione;hydrochloride is sourced from PubChem (CID 18456227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).