C12H16F3NO4 — CID 18456551
tert-butyl 3-oxo-4-(2,2,2-trifluoroacetyl)piperidine-1-carboxylate (PubChem CID 18456551) has the molecular formula C12H16F3NO4 and a molecular weight of 295.26 g/mol. Its IUPAC name is tert-butyl 3-oxo-4-(2,2,2-trifluoroacetyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-oxo-4-(2,2,2-trifluoroacetyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 18456551 |
| Molecular Formula | C12H16F3NO4 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | tert-butyl 3-oxo-4-(2,2,2-trifluoroacetyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)C(F)(F)F)C(=O)C1 |
| InChI | InChI=1S/C12H16F3NO4/c1-11(2,3)20-10(19)16-5-4-7(8(17)6-16)9(18)12(13,14)15/h7H,4-6H2,1-3H3 |
| InChIKey | FUHZEIWXMXDMSS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|