C24H19F3N2O6S — CID 18456954
2-[2-[2-[(5-cyano-2-methoxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetic acid (PubChem CID 18456954) has the molecular formula C24H19F3N2O6S and a molecular weight of 520.49 g/mol. Its IUPAC name is 2-[2-[2-[(5-cyano-2-methoxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetic acid.
| Compound Name | 2-[2-[2-[(5-cyano-2-methoxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 18456954 |
| Molecular Formula | C24H19F3N2O6S |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | 2-[2-[2-[(5-cyano-2-methoxyphenyl)sulfonylamino]ethyl]-5-(3,4,5-trifluorophenyl)phenoxy]acetic acid |
| SMILES | COc1ccc(C#N)cc1S(=O)(=O)NCCc1ccc(-c2cc(F)c(F)c(F)c2)cc1OCC(=O)O |
| InChI | InChI=1S/C24H19F3N2O6S/c1-34-20-5-2-14(12-28)8-22(20)36(32,33)29-7-6-15-3-4-16(11-21(15)35-13-23(30)31)17-9-18(25)24(27)19(26)10-17/h2-5,8-11,29H,6-7,13H2,1H3,(H,30,31) |
| InChIKey | ICUKJKNPDTWUOF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 125.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|