About 1-(2-fluorophenyl)-2,3-bis(4-fluorophenyl)-4-(methylsulfonylmethyl)benzene
1-(2-fluorophenyl)-2,3-bis(4-fluorophenyl)-4-(methylsulfonylmethyl)benzene (PubChem CID 18457089) has the molecular formula C26H19F3O2S
and a molecular weight of 452.50 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2,3-bis(4-fluorophenyl)-4-(methylsulfonylmethyl)benzene.
Molecular Properties
| Compound Name | 1-(2-fluorophenyl)-2,3-bis(4-fluorophenyl)-4-(methylsulfonylmethyl)benzene |
| PubChem CID | 18457089 |
| Molecular Formula | C26H19F3O2S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 1-(2-fluorophenyl)-2,3-bis(4-fluorophenyl)-4-(methylsulfonylmethyl)benzene |
| SMILES | CS(=O)(=O)Cc1ccc(-c2ccccc2F)c(-c2ccc(F)cc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H19F3O2S/c1-32(30,31)16-19-10-15-23(22-4-2-3-5-24(22)29)26(18-8-13-21(28)14-9-18)25(19)17-6-11-20(27)12-7-17/h2-15H,16H2,1H3 |
| InChIKey | UBZPDAVBGCXVJZ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-fluorophenyl)-2,3-bis(4-fluorophenyl)-4-(methylsulfonylmethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluorophenyl)-2,3-bis(4-fluorophenyl)-4-(methylsulfonylmethyl)benzene?
The IUPAC name of 1-(2-fluorophenyl)-2,3-bis(4-fluorophenyl)-4-(methylsulfonylmethyl)benzene (CID 18457089) is 1-(2-fluorophenyl)-2,3-bis(4-fluorophenyl)-4-(methylsulfonylmethyl)benzene.
What is the SMILES notation for 1-(2-fluorophenyl)-2,3-bis(4-fluorophenyl)-4-(methylsulfonylmethyl)benzene?
The canonical SMILES for 1-(2-fluorophenyl)-2,3-bis(4-fluorophenyl)-4-(methylsulfonylmethyl)benzene is CS(=O)(=O)Cc1ccc(-c2ccccc2F)c(-c2ccc(F)cc2)c1-c1ccc(F)cc1.
What is the InChIKey of 1-(2-fluorophenyl)-2,3-bis(4-fluorophenyl)-4-(methylsulfonylmethyl)benzene?
The InChIKey is UBZPDAVBGCXVJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19F3O2S/c1-32(30,31)16-19-10-15-23(22-4-2-3-5-24(22)29)26(18-8-13-21(28)14-9-18)25(19)17-6-11-20(27)12-7-17/h2-15H,16H2,1H3.
What are the key properties of 1-(2-fluorophenyl)-2,3-bis(4-fluorophenyl)-4-(methylsulfonylmethyl)benzene?
1-(2-fluorophenyl)-2,3-bis(4-fluorophenyl)-4-(methylsulfonylmethyl)benzene has a molecular weight of 452.50 g/mol, XLogP of 6.65, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluorophenyl)-2,3-bis(4-fluorophenyl)-4-(methylsulfonylmethyl)benzene is sourced from PubChem (CID 18457089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).